C22H17NO3S — CID 141455279
2-[3-(methanesulfinamido)phenyl]-3-(2-phenylethynyl)benzoic acid (PubChem CID 141455279) has the molecular formula C22H17NO3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[3-(methanesulfinamido)phenyl]-3-(2-phenylethynyl)benzoic acid.
| Compound Name | 2-[3-(methanesulfinamido)phenyl]-3-(2-phenylethynyl)benzoic acid |
|---|---|
| PubChem CID | 141455279 |
| Molecular Formula | C22H17NO3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[3-(methanesulfinamido)phenyl]-3-(2-phenylethynyl)benzoic acid |
| SMILES | CS(=O)Nc1cccc(-c2c(C#Cc3ccccc3)cccc2C(=O)O)c1 |
| InChI | InChI=1S/C22H17NO3S/c1-27(26)23-19-11-5-10-18(15-19)21-17(9-6-12-20(21)22(24)25)14-13-16-7-3-2-4-8-16/h2-12,15,23H,1H3,(H,24,25) |
| InChIKey | JXNSVDDBFIWPGM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|