C19H16Cl2N4O2S3 — CID 14145607
1,3-bis[2-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]thiourea (PubChem CID 14145607) has the molecular formula C19H16Cl2N4O2S3 and a molecular weight of 499.47 g/mol. Its IUPAC name is 1,3-bis[2-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]thiourea.
| Compound Name | 1,3-bis[2-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]thiourea |
|---|---|
| PubChem CID | 14145607 |
| Molecular Formula | C19H16Cl2N4O2S3 |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | 1,3-bis[2-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]thiourea |
| SMILES | O=C1CSC(c2ccc(Cl)cc2)N1NC(=S)NN1C(=O)CSC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N4O2S3/c20-13-5-1-11(2-6-13)17-24(15(26)9-29-17)22-19(28)23-25-16(27)10-30-18(25)12-3-7-14(21)8-4-12/h1-8,17-18H,9-10H2,(H2,22,23,28) |
| InChIKey | VJEYWUWJJNAOIQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|