C17H13ClN3O3S2- — CID 6979612
2-[(2S)-3-[(2-chlorophenyl)carbamothioylamino]-4-oxo-1,3-thiazolidin-2-yl]benzoate (PubChem CID 6979612) has the molecular formula C17H13ClN3O3S2- and a molecular weight of 406.90 g/mol. Its IUPAC name is 2-[(2S)-3-[(2-chlorophenyl)carbamothioylamino]-4-oxo-1,3-thiazolidin-2-yl]benzoate.
| Compound Name | 2-[(2S)-3-[(2-chlorophenyl)carbamothioylamino]-4-oxo-1,3-thiazolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 6979612 |
| Molecular Formula | C17H13ClN3O3S2- |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 2-[(2S)-3-[(2-chlorophenyl)carbamothioylamino]-4-oxo-1,3-thiazolidin-2-yl]benzoate |
| SMILES | O=C([O-])c1ccccc1[C@@H]1SCC(=O)N1NC(=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H14ClN3O3S2/c18-12-7-3-4-8-13(12)19-17(25)20-21-14(22)9-26-15(21)10-5-1-2-6-11(10)16(23)24/h1-8,15H,9H2,(H,23,24)(H2,19,20,25)/p-1/t15-/m0/s1 |
| InChIKey | BKKVAGNPBSJGLM-HNNXBMFYSA-M |
| XLogP | 2.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|