C18H13F2O3P — CID 141456915
4-diphenoxyphosphoryl-1,2-difluorobenzene (PubChem CID 141456915) has the molecular formula C18H13F2O3P and a molecular weight of 346.27 g/mol. Its IUPAC name is 4-diphenoxyphosphoryl-1,2-difluorobenzene.
| Compound Name | 4-diphenoxyphosphoryl-1,2-difluorobenzene |
|---|---|
| PubChem CID | 141456915 |
| Molecular Formula | C18H13F2O3P |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 4-diphenoxyphosphoryl-1,2-difluorobenzene |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H13F2O3P/c19-17-12-11-16(13-18(17)20)24(21,22-14-7-3-1-4-8-14)23-15-9-5-2-6-10-15/h1-13H |
| InChIKey | KYFKGCSDTAACSZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|