C26H30Cl2FN5O3 — CID 141457246
butyl N-[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)-2-pyridinyl]carbamate (PubChem CID 141457246) has the molecular formula C26H30Cl2FN5O3 and a molecular weight of 550.46 g/mol. Its IUPAC name is butyl N-[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)-2-pyridinyl]carbamate.
| Compound Name | butyl N-[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 141457246 |
| Molecular Formula | C26H30Cl2FN5O3 |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | butyl N-[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)-2-pyridinyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ncc(-c2cnn(C3CCNCC3)c2)cc1O[C@H](C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C26H30Cl2FN5O3/c1-3-4-11-36-26(35)33-25-22(37-16(2)23-20(27)5-6-21(29)24(23)28)12-17(13-31-25)18-14-32-34(15-18)19-7-9-30-10-8-19/h5-6,12-16,19,30H,3-4,7-11H2,1-2H3,(H,31,33,35)/t16-/m1/s1 |
| InChIKey | ZILZSIXWORAMIP-MRXNPFEDSA-N |
| XLogP | 6.80 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|