C19H20BrCl2FN2O3 — CID 141457251
pentyl N-[5-bromo-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-pyridinyl]carbamate (PubChem CID 141457251) has the molecular formula C19H20BrCl2FN2O3 and a molecular weight of 494.19 g/mol. Its IUPAC name is pentyl N-[5-bromo-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-pyridinyl]carbamate.
| Compound Name | pentyl N-[5-bromo-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 141457251 |
| Molecular Formula | C19H20BrCl2FN2O3 |
| Molecular Weight | 494.19 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | pentyl N-[5-bromo-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-pyridinyl]carbamate |
| SMILES | CCCCCOC(=O)Nc1ncc(Br)cc1O[C@H](C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C19H20BrCl2FN2O3/c1-3-4-5-8-27-19(26)25-18-15(9-12(20)10-24-18)28-11(2)16-13(21)6-7-14(23)17(16)22/h6-7,9-11H,3-5,8H2,1-2H3,(H,24,25,26)/t11-/m1/s1 |
| InChIKey | WVNLALFXRKKLGF-LLVKDONJSA-N |
| XLogP | 7.17 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.19 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|