C16H21NO3 — CID 141458363
(1S,9R,10R)-6-hydroxy-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3-dien-14-one (PubChem CID 141458363) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (1S,9R,10R)-6-hydroxy-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3-dien-14-one.
| Compound Name | (1S,9R,10R)-6-hydroxy-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3-dien-14-one |
|---|---|
| PubChem CID | 141458363 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (1S,9R,10R)-6-hydroxy-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3-dien-14-one |
| SMILES | O=C1CCC[C@H]2[C@H]3CC4=C(C=CCC4O)[C@@]12CC[NH+]3[O-] |
| InChI | InChI=1S/C16H21NO3/c18-14-5-1-3-11-10(14)9-13-12-4-2-6-15(19)16(11,12)7-8-17(13)20/h1,3,12-14,17-18H,2,4-9H2/t12-,13+,14?,16+/m0/s1 |
| InChIKey | JUVHOLSNVCGDQS-RJZWRMDVSA-N |
| XLogP | 0.52 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |