C16H34S2 — CID 141460643
2,2,3-trimethyl-3-(2,2,3-trimethylpentan-3-yldisulfanyl)pentane (PubChem CID 141460643) has the molecular formula C16H34S2 and a molecular weight of 290.58 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-(2,2,3-trimethylpentan-3-yldisulfanyl)pentane.
| Compound Name | 2,2,3-trimethyl-3-(2,2,3-trimethylpentan-3-yldisulfanyl)pentane |
|---|---|
| PubChem CID | 141460643 |
| Molecular Formula | C16H34S2 |
| Molecular Weight | 290.58 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2,2,3-trimethyl-3-(2,2,3-trimethylpentan-3-yldisulfanyl)pentane |
| SMILES | CCC(C)(SSC(C)(CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H34S2/c1-11-15(9,13(3,4)5)17-18-16(10,12-2)14(6,7)8/h11-12H2,1-10H3 |
| InChIKey | VBBDPHXCVIIYGY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.58 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|