C14H16BN3O3 — CID 141461249
[6-amino-5-(1-phenylethylcarbamoyl)-3-pyridinyl]boronic acid (PubChem CID 141461249) has the molecular formula C14H16BN3O3 and a molecular weight of 285.11 g/mol. Its IUPAC name is [6-amino-5-(1-phenylethylcarbamoyl)-3-pyridinyl]boronic acid.
| Compound Name | [6-amino-5-(1-phenylethylcarbamoyl)-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 141461249 |
| Molecular Formula | C14H16BN3O3 |
| Molecular Weight | 285.11 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | [6-amino-5-(1-phenylethylcarbamoyl)-3-pyridinyl]boronic acid |
| SMILES | CC(NC(=O)c1cc(B(O)O)cnc1N)c1ccccc1 |
| InChI | InChI=1S/C14H16BN3O3/c1-9(10-5-3-2-4-6-10)18-14(19)12-7-11(15(20)21)8-17-13(12)16/h2-9,20-21H,1H3,(H2,16,17)(H,18,19) |
| InChIKey | JNRCXGGJYVGSNX-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.11 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|