C18H24ClN3O — CID 141463755
N-(1-adamantyl)-6-chloro-4-propan-2-ylpyridazine-3-carboxamide (PubChem CID 141463755) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is N-(1-adamantyl)-6-chloro-4-propan-2-ylpyridazine-3-carboxamide.
| Compound Name | N-(1-adamantyl)-6-chloro-4-propan-2-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 141463755 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-(1-adamantyl)-6-chloro-4-propan-2-ylpyridazine-3-carboxamide |
| SMILES | CC(C)c1cc(Cl)nnc1C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H24ClN3O/c1-10(2)14-6-15(19)21-22-16(14)17(23)20-18-7-11-3-12(8-18)5-13(4-11)9-18/h6,10-13H,3-5,7-9H2,1-2H3,(H,20,23) |
| InChIKey | RGLHTRJMWKRFSF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |