C14H26O4 — CID 141464729
[3-(2-hydroxyethoxy)-1-methyl-4-propan-2-ylcyclohexyl] acetate (PubChem CID 141464729) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is [3-(2-hydroxyethoxy)-1-methyl-4-propan-2-ylcyclohexyl] acetate.
| Compound Name | [3-(2-hydroxyethoxy)-1-methyl-4-propan-2-ylcyclohexyl] acetate |
|---|---|
| PubChem CID | 141464729 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | [3-(2-hydroxyethoxy)-1-methyl-4-propan-2-ylcyclohexyl] acetate |
| SMILES | CC(=O)OC1(C)CCC(C(C)C)C(OCCO)C1 |
| InChI | InChI=1S/C14H26O4/c1-10(2)12-5-6-14(4,18-11(3)16)9-13(12)17-8-7-15/h10,12-13,15H,5-9H2,1-4H3 |
| InChIKey | PRUOCUXEDXEOBZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |