C12H22O5 — CID 174702395
[(1R,3S,4R)-3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate (PubChem CID 174702395) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is [(1R,3S,4R)-3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate.
| Compound Name | [(1R,3S,4R)-3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate |
|---|---|
| PubChem CID | 174702395 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | [(1R,3S,4R)-3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl] 2,2-dihydroxyacetate |
| SMILES | CC(C)[C@H]1CC[C@@](C)(OC(=O)C(O)O)C[C@@H]1O |
| InChI | InChI=1S/C12H22O5/c1-7(2)8-4-5-12(3,6-9(8)13)17-11(16)10(14)15/h7-10,13-15H,4-6H2,1-3H3/t8-,9+,12-/m1/s1 |
| InChIKey | QYROVHOTLSPJPH-VDDIYKPWSA-N |
| XLogP | 0.42 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|