C19H28O5 — CID 141468283
methyl 5-methoxy-3,5-bis(3-methylbut-2-enoxy)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 141468283) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is methyl 5-methoxy-3,5-bis(3-methylbut-2-enoxy)cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl 5-methoxy-3,5-bis(3-methylbut-2-enoxy)cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 141468283 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | methyl 5-methoxy-3,5-bis(3-methylbut-2-enoxy)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(OCC=C(C)C)=CC(OC)(OCC=C(C)C)C1 |
| InChI | InChI=1S/C19H28O5/c1-14(2)7-9-23-17-11-16(18(20)21-5)12-19(13-17,22-6)24-10-8-15(3)4/h7-8,11,13H,9-10,12H2,1-6H3 |
| InChIKey | FNKZAVBAHVSRBZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|