C14H10N4O2S — CID 141468421
N-(6-pyridin-3-yloxy-3-pyridinyl)-1,2-thiazole-4-carboxamide (PubChem CID 141468421) has the molecular formula C14H10N4O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is N-(6-pyridin-3-yloxy-3-pyridinyl)-1,2-thiazole-4-carboxamide.
| Compound Name | N-(6-pyridin-3-yloxy-3-pyridinyl)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 141468421 |
| Molecular Formula | C14H10N4O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(6-pyridin-3-yloxy-3-pyridinyl)-1,2-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2cccnc2)nc1)c1cnsc1 |
| InChI | InChI=1S/C14H10N4O2S/c19-14(10-6-17-21-9-10)18-11-3-4-13(16-7-11)20-12-2-1-5-15-8-12/h1-9H,(H,18,19) |
| InChIKey | NPMSHHSQXOIWMY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |