About 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide
4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide (PubChem CID 75392520) has the molecular formula C19H15N5O2S
and a molecular weight of 377.43 g/mol. Its IUPAC name is 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide |
| PubChem CID | 75392520 |
| Molecular Formula | C19H15N5O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide |
| SMILES | Cc1nc(-c2c[nH]c(C(=O)Nc3ccc(Oc4cccnc4)nc3)c2)cs1 |
| InChI | InChI=1S/C19H15N5O2S/c1-12-23-17(11-27-12)13-7-16(21-8-13)19(25)24-14-4-5-18(22-9-14)26-15-3-2-6-20-10-15/h2-11,21H,1H3,(H,24,25) |
| InChIKey | YREYYCISQJMWKN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide (CID 75392520) is 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide is Cc1nc(-c2c[nH]c(C(=O)Nc3ccc(Oc4cccnc4)nc3)c2)cs1.
What is the InChIKey of 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide?
The InChIKey is YREYYCISQJMWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N5O2S/c1-12-23-17(11-27-12)13-7-16(21-8-13)19(25)24-14-4-5-18(22-9-14)26-15-3-2-6-20-10-15/h2-11,21H,1H3,(H,24,25).
What are the key properties of 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide?
4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide has a molecular weight of 377.43 g/mol, XLogP of 4.28, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-thiazol-4-yl)-N-(6-pyridin-3-yloxy-3-pyridinyl)-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 75392520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).