C28H28N6O2 — CID 141473151
1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-[[2-(1H-indazol-5-yloxy)phenyl]methyl]urea (PubChem CID 141473151) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-[[2-(1H-indazol-5-yloxy)phenyl]methyl]urea.
| Compound Name | 1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-[[2-(1H-indazol-5-yloxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 141473151 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-[[2-(1H-indazol-5-yloxy)phenyl]methyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)NCc2ccccc2Oc2ccc3[nH]ncc3c2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H28N6O2/c1-28(2,3)25-16-26(34(33-25)21-10-5-4-6-11-21)31-27(35)29-17-19-9-7-8-12-24(19)36-22-13-14-23-20(15-22)18-30-32-23/h4-16,18H,17H2,1-3H3,(H,30,32)(H2,29,31,35) |
| InChIKey | RANRFRAHPHGQRW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |