C25H30N6O2 — CID 173490347
1-[[2-(1-amino-3-iminoprop-1-enoxy)phenyl]methyl]-3-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]urea (PubChem CID 173490347) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-[[2-(1-amino-3-iminoprop-1-enoxy)phenyl]methyl]-3-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]urea.
| Compound Name | 1-[[2-(1-amino-3-iminoprop-1-enoxy)phenyl]methyl]-3-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 173490347 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-[[2-(1-amino-3-iminoprop-1-enoxy)phenyl]methyl]-3-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]urea |
| SMILES | [H]/N=C/C=C(N)Oc1ccccc1CNC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C25H30N6O2/c1-17-9-11-19(12-10-17)31-23(15-21(30-31)25(2,3)4)29-24(32)28-16-18-7-5-6-8-20(18)33-22(27)13-14-26/h5-15,26H,16,27H2,1-4H3,(H2,28,29,32)/b22-13?,26-14+ |
| InChIKey | SMAJTVMOYOIEFQ-JWURGCMLSA-N |
| XLogP | 4.63 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|