C28H30ClF3N6O2 — CID 173490338
[2-[[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]methyl]-4-(trifluoromethyl)phenyl] (Z)-3-amino-N-(1-chloroethenyl)prop-2-enimidate (PubChem CID 173490338) has the molecular formula C28H30ClF3N6O2 and a molecular weight of 575.04 g/mol. Its IUPAC name is [2-[[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]methyl]-4-(trifluoromethyl)phenyl] (Z)-3-amino-N-(1-chloroethenyl)prop-2-enimidate.
| Compound Name | [2-[[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]methyl]-4-(trifluoromethyl)phenyl] (Z)-3-amino-N-(1-chloroethenyl)prop-2-enimidate |
|---|---|
| PubChem CID | 173490338 |
| Molecular Formula | C28H30ClF3N6O2 |
| Molecular Weight | 575.04 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | [2-[[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]methyl]-4-(trifluoromethyl)phenyl] (Z)-3-amino-N-(1-chloroethenyl)prop-2-enimidate |
| SMILES | C=C(Cl)N=C(/C=C\N)Oc1ccc(C(F)(F)F)cc1CNC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C28H30ClF3N6O2/c1-17-6-9-21(10-7-17)38-24(15-23(37-38)27(3,4)5)36-26(39)34-16-19-14-20(28(30,31)32)8-11-22(19)40-25(12-13-33)35-18(2)29/h6-15H,2,16,33H2,1,3-5H3,(H2,34,36,39)/b13-12-,35-25? |
| InChIKey | UFZSWADFCYCJEB-PKRGCVMUSA-N |
| XLogP | 6.78 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.04 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|