C31H33N7O4 — CID 173490340
[2-[[[3-(furan-2-yl)-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]methyl]phenyl] (Z)-3-amino-N-(1-morpholin-4-ylethenyl)prop-2-enimidate (PubChem CID 173490340) has the molecular formula C31H33N7O4 and a molecular weight of 567.65 g/mol. Its IUPAC name is [2-[[[3-(furan-2-yl)-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]methyl]phenyl] (Z)-3-amino-N-(1-morpholin-4-ylethenyl)prop-2-enimidate.
| Compound Name | [2-[[[3-(furan-2-yl)-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]methyl]phenyl] (Z)-3-amino-N-(1-morpholin-4-ylethenyl)prop-2-enimidate |
|---|---|
| PubChem CID | 173490340 |
| Molecular Formula | C31H33N7O4 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | [2-[[[3-(furan-2-yl)-1-(4-methylphenyl)pyrazol-5-yl]carbamoylamino]methyl]phenyl] (Z)-3-amino-N-(1-morpholin-4-ylethenyl)prop-2-enimidate |
| SMILES | C=C(N=C(/C=C\N)Oc1ccccc1CNC(=O)Nc1cc(-c2ccco2)nn1-c1ccc(C)cc1)N1CCOCC1 |
| InChI | InChI=1S/C31H33N7O4/c1-22-9-11-25(12-10-22)38-29(20-26(36-38)28-8-5-17-41-28)35-31(39)33-21-24-6-3-4-7-27(24)42-30(13-14-32)34-23(2)37-15-18-40-19-16-37/h3-14,17,20H,2,15-16,18-19,21,32H2,1H3,(H2,33,35,39)/b14-13-,34-30? |
| InChIKey | KMUANYPKARWLOH-IFDVRFSNSA-N |
| XLogP | 4.82 |
| TPSA | 132.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|