C23H26N6O2 — CID 162663368
1-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea (PubChem CID 162663368) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea.
| Compound Name | 1-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 162663368 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea |
| SMILES | COc1ccc(-n2nc(C(C)(C)C)cc2CNC(=O)Nc2cccc3[nH]ncc23)cc1 |
| InChI | InChI=1S/C23H26N6O2/c1-23(2,3)21-12-16(29(28-21)15-8-10-17(31-4)11-9-15)13-24-22(30)26-19-6-5-7-20-18(19)14-25-27-20/h5-12,14H,13H2,1-4H3,(H,25,27)(H2,24,26,30) |
| InChIKey | SSLOCBZSJSUZGE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |