C19H24F3N7O — CID 66644415
1-[[1-(dipropylamino)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea (PubChem CID 66644415) has the molecular formula C19H24F3N7O and a molecular weight of 423.44 g/mol. Its IUPAC name is 1-[[1-(dipropylamino)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea.
| Compound Name | 1-[[1-(dipropylamino)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 66644415 |
| Molecular Formula | C19H24F3N7O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[[1-(dipropylamino)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea |
| SMILES | CCCN(CCC)n1nc(C(F)(F)F)cc1CNC(=O)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C19H24F3N7O/c1-3-8-28(9-4-2)29-13(10-17(27-29)19(20,21)22)11-23-18(30)25-15-6-5-7-16-14(15)12-24-26-16/h5-7,10,12H,3-4,8-9,11H2,1-2H3,(H,24,26)(H2,23,25,30) |
| InChIKey | TYQXEBDAFOEJAK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |