C20H22FN5O — CID 11383021
1-[(3-fluoro-4-piperidin-1-ylphenyl)methyl]-3-(1H-indazol-4-yl)urea (PubChem CID 11383021) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-[(3-fluoro-4-piperidin-1-ylphenyl)methyl]-3-(1H-indazol-4-yl)urea.
| Compound Name | 1-[(3-fluoro-4-piperidin-1-ylphenyl)methyl]-3-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 11383021 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-[(3-fluoro-4-piperidin-1-ylphenyl)methyl]-3-(1H-indazol-4-yl)urea |
| SMILES | O=C(NCc1ccc(N2CCCCC2)c(F)c1)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C20H22FN5O/c21-16-11-14(7-8-19(16)26-9-2-1-3-10-26)12-22-20(27)24-17-5-4-6-18-15(17)13-23-25-18/h4-8,11,13H,1-3,9-10,12H2,(H,23,25)(H2,22,24,27) |
| InChIKey | XLPAVICNSHNEJK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |