C22H24ClN5O — CID 22337581
1-[[4-(8-azabicyclo[3.2.1]octan-8-yl)-3-chlorophenyl]methyl]-3-(1H-indazol-4-yl)urea (PubChem CID 22337581) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is 1-[[4-(8-azabicyclo[3.2.1]octan-8-yl)-3-chlorophenyl]methyl]-3-(1H-indazol-4-yl)urea.
| Compound Name | 1-[[4-(8-azabicyclo[3.2.1]octan-8-yl)-3-chlorophenyl]methyl]-3-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 22337581 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[[4-(8-azabicyclo[3.2.1]octan-8-yl)-3-chlorophenyl]methyl]-3-(1H-indazol-4-yl)urea |
| SMILES | O=C(NCc1ccc(N2C3CCCC2CC3)c(Cl)c1)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C22H24ClN5O/c23-18-11-14(7-10-21(18)28-15-3-1-4-16(28)9-8-15)12-24-22(29)26-19-5-2-6-20-17(19)13-25-27-20/h2,5-7,10-11,13,15-16H,1,3-4,8-9,12H2,(H,25,27)(H2,24,26,29) |
| InChIKey | ZDTTUYJJORJBME-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |