C23H24Cl3N5O — CID 90937885
1-[[4-(8-azabicyclo[3.2.1]octan-8-yl)-3-(trichloromethyl)phenyl]methyl]-3-(1H-indazol-4-yl)urea (PubChem CID 90937885) has the molecular formula C23H24Cl3N5O and a molecular weight of 492.84 g/mol. Its IUPAC name is 1-[[4-(8-azabicyclo[3.2.1]octan-8-yl)-3-(trichloromethyl)phenyl]methyl]-3-(1H-indazol-4-yl)urea.
| Compound Name | 1-[[4-(8-azabicyclo[3.2.1]octan-8-yl)-3-(trichloromethyl)phenyl]methyl]-3-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 90937885 |
| Molecular Formula | C23H24Cl3N5O |
| Molecular Weight | 492.84 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 1-[[4-(8-azabicyclo[3.2.1]octan-8-yl)-3-(trichloromethyl)phenyl]methyl]-3-(1H-indazol-4-yl)urea |
| SMILES | O=C(NCc1ccc(N2C3CCCC2CC3)c(C(Cl)(Cl)Cl)c1)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C23H24Cl3N5O/c24-23(25,26)18-11-14(7-10-21(18)31-15-3-1-4-16(31)9-8-15)12-27-22(32)29-19-5-2-6-20-17(19)13-28-30-20/h2,5-7,10-11,13,15-16H,1,3-4,8-9,12H2,(H,28,30)(H2,27,29,32) |
| InChIKey | GJLZKZAWVGNBNN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.84 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|