C24H26FN5O2 — CID 37314134
2-[(4-fluorophenyl)methylcarbamoylamino]-N-(5-piperidin-1-ylisoquinolin-8-yl)acetamide (PubChem CID 37314134) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylcarbamoylamino]-N-(5-piperidin-1-ylisoquinolin-8-yl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-(5-piperidin-1-ylisoquinolin-8-yl)acetamide |
|---|---|
| PubChem CID | 37314134 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-(5-piperidin-1-ylisoquinolin-8-yl)acetamide |
| SMILES | O=C(CNC(=O)NCc1ccc(F)cc1)Nc1ccc(N2CCCCC2)c2ccncc12 |
| InChI | InChI=1S/C24H26FN5O2/c25-18-6-4-17(5-7-18)14-27-24(32)28-16-23(31)29-21-8-9-22(30-12-2-1-3-13-30)19-10-11-26-15-20(19)21/h4-11,15H,1-3,12-14,16H2,(H,29,31)(H2,27,28,32) |
| InChIKey | RABUOGSQFRWYCM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |