C36H69AlO6 — CID 141473341
bis(2,2,7,7-tetramethyloctanoyloxy)alumanyl 2,2,7,7-tetramethyloctanoate (PubChem CID 141473341) has the molecular formula C36H69AlO6 and a molecular weight of 624.92 g/mol. Its IUPAC name is bis(2,2,7,7-tetramethyloctanoyloxy)alumanyl 2,2,7,7-tetramethyloctanoate.
| Compound Name | bis(2,2,7,7-tetramethyloctanoyloxy)alumanyl 2,2,7,7-tetramethyloctanoate |
|---|---|
| PubChem CID | 141473341 |
| Molecular Formula | C36H69AlO6 |
| Molecular Weight | 624.92 g/mol |
| Exact Mass | 624.49 |
| IUPAC Name | bis(2,2,7,7-tetramethyloctanoyloxy)alumanyl 2,2,7,7-tetramethyloctanoate |
| SMILES | CC(C)(C)CCCCC(C)(C)C(=O)O[Al](OC(=O)C(C)(C)CCCCC(C)(C)C)OC(=O)C(C)(C)CCCCC(C)(C)C |
| InChI | InChI=1S/3C12H24O2.Al/c3*1-11(2,3)8-6-7-9-12(4,5)10(13)14;/h3*6-9H2,1-5H3,(H,13,14);/q;;;+3/p-3 |
| InChIKey | HJOZAGWGZFXVNU-UHFFFAOYSA-K |
| XLogP | 10.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.92 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|