C32H31N5O5 — CID 141473660
1-[3-(6,7-dimethoxyquinolin-4-yl)oxy-4-methylphenyl]-3-[4-[(1-prop-2-enoyl-2,3-dihydropyrrol-4-yl)amino]phenyl]urea (PubChem CID 141473660) has the molecular formula C32H31N5O5 and a molecular weight of 565.63 g/mol. Its IUPAC name is 1-[3-(6,7-dimethoxyquinolin-4-yl)oxy-4-methylphenyl]-3-[4-[(1-prop-2-enoyl-2,3-dihydropyrrol-4-yl)amino]phenyl]urea.
| Compound Name | 1-[3-(6,7-dimethoxyquinolin-4-yl)oxy-4-methylphenyl]-3-[4-[(1-prop-2-enoyl-2,3-dihydropyrrol-4-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 141473660 |
| Molecular Formula | C32H31N5O5 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 1-[3-(6,7-dimethoxyquinolin-4-yl)oxy-4-methylphenyl]-3-[4-[(1-prop-2-enoyl-2,3-dihydropyrrol-4-yl)amino]phenyl]urea |
| SMILES | C=CC(=O)N1C=C(Nc2ccc(NC(=O)Nc3ccc(C)c(Oc4ccnc5cc(OC)c(OC)cc45)c3)cc2)CC1 |
| InChI | InChI=1S/C32H31N5O5/c1-5-31(38)37-15-13-24(19-37)34-21-8-10-22(11-9-21)35-32(39)36-23-7-6-20(2)28(16-23)42-27-12-14-33-26-18-30(41-4)29(40-3)17-25(26)27/h5-12,14,16-19,34H,1,13,15H2,2-4H3,(H2,35,36,39) |
| InChIKey | JDTNGGUETUVNMJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|