About trimethyl 4-oxohept-5-en-3-yl silicate
trimethyl 4-oxohept-5-en-3-yl silicate (PubChem CID 141474259) has the molecular formula C10H20O5Si
and a molecular weight of 248.35 g/mol. Its IUPAC name is trimethyl 4-oxohept-5-en-3-yl silicate.
Molecular Properties
| Compound Name | trimethyl 4-oxohept-5-en-3-yl silicate |
| PubChem CID | 141474259 |
| Molecular Formula | C10H20O5Si |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | trimethyl 4-oxohept-5-en-3-yl silicate |
| SMILES | CC=CC(=O)C(CC)O[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H20O5Si/c1-6-8-9(11)10(7-2)15-16(12-3,13-4)14-5/h6,8,10H,7H2,1-5H3 |
| InChIKey | KTRSVMRLUULAIR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze trimethyl 4-oxohept-5-en-3-yl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl 4-oxohept-5-en-3-yl silicate?
The IUPAC name of trimethyl 4-oxohept-5-en-3-yl silicate (CID 141474259) is trimethyl 4-oxohept-5-en-3-yl silicate.
What is the SMILES notation for trimethyl 4-oxohept-5-en-3-yl silicate?
The canonical SMILES for trimethyl 4-oxohept-5-en-3-yl silicate is CC=CC(=O)C(CC)O[Si](OC)(OC)OC.
What is the InChIKey of trimethyl 4-oxohept-5-en-3-yl silicate?
The InChIKey is KTRSVMRLUULAIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5Si/c1-6-8-9(11)10(7-2)15-16(12-3,13-4)14-5/h6,8,10H,7H2,1-5H3.
What are the key properties of trimethyl 4-oxohept-5-en-3-yl silicate?
trimethyl 4-oxohept-5-en-3-yl silicate has a molecular weight of 248.35 g/mol, XLogP of 1.30, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl 4-oxohept-5-en-3-yl silicate is sourced from PubChem (CID 141474259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).