C9H19NO5P+ — CID 160796745
trimethyl-(3-oxo-2-phosphonooxyhex-4-enyl)azanium (PubChem CID 160796745) has the molecular formula C9H19NO5P+ and a molecular weight of 252.23 g/mol. Its IUPAC name is trimethyl-(3-oxo-2-phosphonooxyhex-4-enyl)azanium.
| Compound Name | trimethyl-(3-oxo-2-phosphonooxyhex-4-enyl)azanium |
|---|---|
| PubChem CID | 160796745 |
| Molecular Formula | C9H19NO5P+ |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | trimethyl-(3-oxo-2-phosphonooxyhex-4-enyl)azanium |
| SMILES | CC=CC(=O)C(C[N+](C)(C)C)OP(=O)(O)O |
| InChI | InChI=1S/C9H18NO5P/c1-5-6-8(11)9(7-10(2,3)4)15-16(12,13)14/h5-6,9H,7H2,1-4H3,(H-,12,13,14)/p+1 |
| InChIKey | SCNULXUJZDZFJG-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|