C25H41NO5P+ — CID 19070748
[(4E,6E,8E,10E)-5,9-dimethyl-3-oxo-2-phosphonooxy-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenyl]-trimethylazanium (PubChem CID 19070748) has the molecular formula C25H41NO5P+ and a molecular weight of 466.58 g/mol. Its IUPAC name is [(4E,6E,8E,10E)-5,9-dimethyl-3-oxo-2-phosphonooxy-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenyl]-trimethylazanium.
| Compound Name | [(4E,6E,8E,10E)-5,9-dimethyl-3-oxo-2-phosphonooxy-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenyl]-trimethylazanium |
|---|---|
| PubChem CID | 19070748 |
| Molecular Formula | C25H41NO5P+ |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | [(4E,6E,8E,10E)-5,9-dimethyl-3-oxo-2-phosphonooxy-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenyl]-trimethylazanium |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)C(C[N+](C)(C)C)OP(=O)(O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H40NO5P/c1-19(14-15-22-21(3)13-10-16-25(22,4)5)11-9-12-20(2)17-23(27)24(18-26(6,7)8)31-32(28,29)30/h9,11-12,14-15,17,24H,10,13,16,18H2,1-8H3,(H-,28,29,30)/p+1/b12-9+,15-14+,19-11+,20-17+ |
| InChIKey | KVBKNNJWHODMEQ-XUJYDZMUSA-O |
| XLogP | 5.27 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|