C6H15ClNO6P — CID 141225769
acetyl-(2-hydroxy-1-phosphonooxyethyl)-dimethylazanium chloride (PubChem CID 141225769) has the molecular formula C6H15ClNO6P and a molecular weight of 263.61 g/mol. Its IUPAC name is acetyl-(2-hydroxy-1-phosphonooxyethyl)-dimethylazanium chloride.
| Compound Name | acetyl-(2-hydroxy-1-phosphonooxyethyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 141225769 |
| Molecular Formula | C6H15ClNO6P |
| Molecular Weight | 263.61 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | acetyl-(2-hydroxy-1-phosphonooxyethyl)-dimethylazanium chloride |
| SMILES | CC(=O)[N+](C)(C)C(CO)OP(=O)(O)O.[Cl-] |
| InChI | InChI=1S/C6H14NO6P.ClH/c1-5(9)7(2,3)6(4-8)13-14(10,11)12;/h6,8H,4H2,1-3H3,(H-,10,11,12);1H |
| InChIKey | IEZQLFLIRVTBSW-UHFFFAOYSA-N |
| XLogP | -3.96 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.61 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|