C12H12N4O — CID 14147572
(1R,9R)-11-amino-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-10-carbonitrile (PubChem CID 14147572) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is (1R,9R)-11-amino-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-10-carbonitrile.
| Compound Name | (1R,9R)-11-amino-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-10-carbonitrile |
|---|---|
| PubChem CID | 14147572 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (1R,9R)-11-amino-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-10-carbonitrile |
| SMILES | C[C@@]12C[C@@H](N=C(N)N1C#N)c1ccccc1O2 |
| InChI | InChI=1S/C12H12N4O/c1-12-6-9(15-11(14)16(12)7-13)8-4-2-3-5-10(8)17-12/h2-5,9H,6H2,1H3,(H2,14,15)/t9-,12-/m1/s1 |
| InChIKey | CLSSBFDCWDFWNX-BXKDBHETSA-N |
| XLogP | 1.34 |
| TPSA | 74.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|