C13H24O2Si — CID 141477581
1-bicyclo[2.2.1]hept-2-enyl-dimethoxy-(2-methylpropyl)silane (PubChem CID 141477581) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is 1-bicyclo[2.2.1]hept-2-enyl-dimethoxy-(2-methylpropyl)silane.
| Compound Name | 1-bicyclo[2.2.1]hept-2-enyl-dimethoxy-(2-methylpropyl)silane |
|---|---|
| PubChem CID | 141477581 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-bicyclo[2.2.1]hept-2-enyl-dimethoxy-(2-methylpropyl)silane |
| SMILES | CO[Si](CC(C)C)(OC)C12C=CC(CC1)C2 |
| InChI | InChI=1S/C13H24O2Si/c1-11(2)10-16(14-3,15-4)13-7-5-12(9-13)6-8-13/h5,7,11-12H,6,8-10H2,1-4H3 |
| InChIKey | WVLJQIOIQMSDKN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|