C13H27O3Si4 — CID 22325800
CID 22325800 (PubChem CID 22325800) has the molecular formula C13H27O3Si4 and a molecular weight of 343.70 g/mol.
| Compound Name | CID 22325800 |
|---|---|
| PubChem CID | 22325800 |
| Molecular Formula | C13H27O3Si4 |
| Molecular Weight | 343.70 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[Si](O[Si](C)C)(O[Si](C)C)C12C=CC(CC1)C2 |
| InChI | InChI=1S/C13H27O3Si4/c1-17(2)14-20(15-18(3)4,16-19(5)6)13-9-7-12(11-13)8-10-13/h7,9,12H,8,10-11H2,1-6H3 |
| InChIKey | YWDYFOANNJSGPT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|