C7H14N3P3 — CID 173269047
1-(1-bicyclo[2.2.1]hept-2-enyl)-1,3,5,2,4,6-triazatriphosphinane (PubChem CID 173269047) has the molecular formula C7H14N3P3 and a molecular weight of 233.13 g/mol. Its IUPAC name is 1-(1-bicyclo[2.2.1]hept-2-enyl)-1,3,5,2,4,6-triazatriphosphinane.
| Compound Name | 1-(1-bicyclo[2.2.1]hept-2-enyl)-1,3,5,2,4,6-triazatriphosphinane |
|---|---|
| PubChem CID | 173269047 |
| Molecular Formula | C7H14N3P3 |
| Molecular Weight | 233.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 1-(1-bicyclo[2.2.1]hept-2-enyl)-1,3,5,2,4,6-triazatriphosphinane |
| SMILES | C1=CC2(N3PNPNP3)CCC1C2 |
| InChI | InChI=1S/C7H14N3P3/c1-3-7(4-2-6(1)5-7)10-12-8-11-9-13-10/h1,3,6,8-9,11-13H,2,4-5H2 |
| InChIKey | BKZCJHSZXHXEPR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.13 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|