About O-(iodomethyl) ethanethioate
O-(iodomethyl) ethanethioate (PubChem CID 141477930) has the molecular formula C3H5IOS
and a molecular weight of 216.04 g/mol. Its IUPAC name is O-(iodomethyl) ethanethioate.
Molecular Properties
| Compound Name | O-(iodomethyl) ethanethioate |
| PubChem CID | 141477930 |
| Molecular Formula | C3H5IOS |
| Molecular Weight | 216.04 g/mol |
| Exact Mass | 215.91 |
| IUPAC Name | O-(iodomethyl) ethanethioate |
| SMILES | CC(=S)OCI |
| InChI | InChI=1S/C3H5IOS/c1-3(6)5-2-4/h2H2,1H3 |
| InChIKey | GAOKNRCVJYROCV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.04 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(iodomethyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(iodomethyl) ethanethioate?
The IUPAC name of O-(iodomethyl) ethanethioate (CID 141477930) is O-(iodomethyl) ethanethioate.
What is the SMILES notation for O-(iodomethyl) ethanethioate?
The canonical SMILES for O-(iodomethyl) ethanethioate is CC(=S)OCI.
What is the InChIKey of O-(iodomethyl) ethanethioate?
The InChIKey is GAOKNRCVJYROCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5IOS/c1-3(6)5-2-4/h2H2,1H3.
What are the key properties of O-(iodomethyl) ethanethioate?
O-(iodomethyl) ethanethioate has a molecular weight of 216.04 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(iodomethyl) ethanethioate is sourced from PubChem (CID 141477930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).