C40H56N2O4 — CID 141477953
dimethyl 2,5-bis[2-[methyl(octyl)amino]phenyl]benzene-1,4-dicarboxylate (PubChem CID 141477953) has the molecular formula C40H56N2O4 and a molecular weight of 628.90 g/mol. Its IUPAC name is dimethyl 2,5-bis[2-[methyl(octyl)amino]phenyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2,5-bis[2-[methyl(octyl)amino]phenyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 141477953 |
| Molecular Formula | C40H56N2O4 |
| Molecular Weight | 628.90 g/mol |
| Exact Mass | 628.42 |
| IUPAC Name | dimethyl 2,5-bis[2-[methyl(octyl)amino]phenyl]benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCN(C)c1ccccc1-c1cc(C(=O)OC)c(-c2ccccc2N(C)CCCCCCCC)cc1C(=O)OC |
| InChI | InChI=1S/C40H56N2O4/c1-7-9-11-13-15-21-27-41(3)37-25-19-17-23-31(37)33-29-36(40(44)46-6)34(30-35(33)39(43)45-5)32-24-18-20-26-38(32)42(4)28-22-16-14-12-10-8-2/h17-20,23-26,29-30H,7-16,21-22,27-28H2,1-6H3 |
| InChIKey | XEJJKEGTRNPBKU-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.90 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|