C15H25N3O — CID 67412773
N',N'-dimethyl-2-[methyl(pentyl)amino]benzohydrazide (PubChem CID 67412773) has the molecular formula C15H25N3O and a molecular weight of 263.39 g/mol. Its IUPAC name is N',N'-dimethyl-2-[methyl(pentyl)amino]benzohydrazide.
| Compound Name | N',N'-dimethyl-2-[methyl(pentyl)amino]benzohydrazide |
|---|---|
| PubChem CID | 67412773 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | N',N'-dimethyl-2-[methyl(pentyl)amino]benzohydrazide |
| SMILES | CCCCCN(C)c1ccccc1C(=O)NN(C)C |
| InChI | InChI=1S/C15H25N3O/c1-5-6-9-12-18(4)14-11-8-7-10-13(14)15(19)16-17(2)3/h7-8,10-11H,5-6,9,12H2,1-4H3,(H,16,19) |
| InChIKey | FHBKEOWNOBKGDJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|