C18H31ClO — CID 141478978
(Z,6S,7S)-6-chlorooctadec-3-en-9-yn-7-ol (PubChem CID 141478978) has the molecular formula C18H31ClO and a molecular weight of 298.90 g/mol. Its IUPAC name is (Z,6S,7S)-6-chlorooctadec-3-en-9-yn-7-ol.
| Compound Name | (Z,6S,7S)-6-chlorooctadec-3-en-9-yn-7-ol |
|---|---|
| PubChem CID | 141478978 |
| Molecular Formula | C18H31ClO |
| Molecular Weight | 298.90 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (Z,6S,7S)-6-chlorooctadec-3-en-9-yn-7-ol |
| SMILES | CC/C=C\C[C@H](Cl)[C@@H](O)CC#CCCCCCCCC |
| InChI | InChI=1S/C18H31ClO/c1-3-5-7-8-9-10-11-12-14-16-18(20)17(19)15-13-6-4-2/h6,13,17-18,20H,3-5,7-11,15-16H2,1-2H3/b13-6-/t17-,18-/m0/s1 |
| InChIKey | YHYCIKWGCOCIJM-RMSKAEBXSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.90 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|