C15H21ClO — CID 162938534
6-chloropentadeca-3,9,12-trien-1-yn-7-ol (PubChem CID 162938534) has the molecular formula C15H21ClO and a molecular weight of 252.78 g/mol. Its IUPAC name is 6-chloropentadeca-3,9,12-trien-1-yn-7-ol.
| Compound Name | 6-chloropentadeca-3,9,12-trien-1-yn-7-ol |
|---|---|
| PubChem CID | 162938534 |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 6-chloropentadeca-3,9,12-trien-1-yn-7-ol |
| SMILES | C#CC=CCC(Cl)C(O)CC=CCC=CCC |
| InChI | InChI=1S/C15H21ClO/c1-3-5-7-8-9-11-13-15(17)14(16)12-10-6-4-2/h2,5-7,9-11,14-15,17H,3,8,12-13H2,1H3 |
| InChIKey | XZSYLSQFUHFUBD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|