C19H31ClO — CID 23729524
(4R,5S)-4-chlorononadeca-6,9-diyn-5-ol (PubChem CID 23729524) has the molecular formula C19H31ClO and a molecular weight of 310.91 g/mol. Its IUPAC name is (4R,5S)-4-chlorononadeca-6,9-diyn-5-ol.
| Compound Name | (4R,5S)-4-chlorononadeca-6,9-diyn-5-ol |
|---|---|
| PubChem CID | 23729524 |
| Molecular Formula | C19H31ClO |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (4R,5S)-4-chlorononadeca-6,9-diyn-5-ol |
| SMILES | CCCCCCCCCC#CCC#C[C@H](O)[C@H](Cl)CCC |
| InChI | InChI=1S/C19H31ClO/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-19(21)18(20)16-4-2/h18-19,21H,3-11,14,16H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | KYDNOKWYZHJFEO-MOPGFXCFSA-N |
| XLogP | 5.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|