About ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate
ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate (PubChem CID 141479973) has the molecular formula C18H28N2O3S
and a molecular weight of 352.50 g/mol. Its IUPAC name is ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate |
| PubChem CID | 141479973 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate |
| SMILES | CCOC(=O)C(CC)C1CCN[C@H](C(=O)Nc2c(C)csc2C)C1 |
| InChI | InChI=1S/C18H28N2O3S/c1-5-14(18(22)23-6-2)13-7-8-19-15(9-13)17(21)20-16-11(3)10-24-12(16)4/h10,13-15,19H,5-9H2,1-4H3,(H,20,21)/t13?,14?,15-/m0/s1 |
| InChIKey | MGQIOSAJNZEUQK-NRXISQOPSA-N |
| XLogP | 3.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate?
The IUPAC name of ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate (CID 141479973) is ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate.
What is the SMILES notation for ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate?
The canonical SMILES for ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate is CCOC(=O)C(CC)C1CCN[C@H](C(=O)Nc2c(C)csc2C)C1.
What is the InChIKey of ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate?
The InChIKey is MGQIOSAJNZEUQK-NRXISQOPSA-N. The full InChI is InChI=1S/C18H28N2O3S/c1-5-14(18(22)23-6-2)13-7-8-19-15(9-13)17(21)20-16-11(3)10-24-12(16)4/h10,13-15,19H,5-9H2,1-4H3,(H,20,21)/t13?,14?,15-/m0/s1.
What are the key properties of ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate?
ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate has a molecular weight of 352.50 g/mol, XLogP of 3.26, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2S)-2-[(2,4-dimethylthiophen-3-yl)carbamoyl]piperidin-4-yl]butanoate is sourced from PubChem (CID 141479973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).