C15H10BrN3OS — CID 141480606
4-bromo-5'-phenylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one (PubChem CID 141480606) has the molecular formula C15H10BrN3OS and a molecular weight of 360.24 g/mol. Its IUPAC name is 4-bromo-5'-phenylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one.
| Compound Name | 4-bromo-5'-phenylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
|---|---|
| PubChem CID | 141480606 |
| Molecular Formula | C15H10BrN3OS |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 4-bromo-5'-phenylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
| SMILES | O=C1Nc2cccc(Br)c2C12NN=C(c1ccccc1)S2 |
| InChI | InChI=1S/C15H10BrN3OS/c16-10-7-4-8-11-12(10)15(14(20)17-11)19-18-13(21-15)9-5-2-1-3-6-9/h1-8,19H,(H,17,20) |
| InChIKey | ZJBSEHPPXYJALU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|