C14H19N5OS2 — CID 141483983
1-(2-methylphenyl)-1-[5-(2-methylpropylsulfanyl)-2-sulfanyl-1,2,4-triazol-3-yl]urea (PubChem CID 141483983) has the molecular formula C14H19N5OS2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-(2-methylphenyl)-1-[5-(2-methylpropylsulfanyl)-2-sulfanyl-1,2,4-triazol-3-yl]urea.
| Compound Name | 1-(2-methylphenyl)-1-[5-(2-methylpropylsulfanyl)-2-sulfanyl-1,2,4-triazol-3-yl]urea |
|---|---|
| PubChem CID | 141483983 |
| Molecular Formula | C14H19N5OS2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-(2-methylphenyl)-1-[5-(2-methylpropylsulfanyl)-2-sulfanyl-1,2,4-triazol-3-yl]urea |
| SMILES | Cc1ccccc1N(C(N)=O)c1nc(SCC(C)C)nn1S |
| InChI | InChI=1S/C14H19N5OS2/c1-9(2)8-22-13-16-14(19(21)17-13)18(12(15)20)11-7-5-4-6-10(11)3/h4-7,9,21H,8H2,1-3H3,(H2,15,20) |
| InChIKey | PEYZYPPTDUDBQU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|