About N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole
N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole (PubChem CID 87173322) has the molecular formula C19H23N3OS
and a molecular weight of 341.48 g/mol. Its IUPAC name is N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole.
Molecular Properties
| Compound Name | N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole |
| PubChem CID | 87173322 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole |
| SMILES | Cc1ccccc1N(C)CC(C)C.O=S=C1N=c2ccccc2=N1 |
| InChI | InChI=1S/C12H19N.C7H4N2OS/c1-10(2)9-13(4)12-8-6-5-7-11(12)3;10-11-7-8-5-3-1-2-4-6(5)9-7/h5-8,10H,9H2,1-4H3;1-4H |
| InChIKey | PFXQSXDUTRTCKS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole?
The IUPAC name of N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole (CID 87173322) is N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole.
What is the SMILES notation for N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole?
The canonical SMILES for N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole is Cc1ccccc1N(C)CC(C)C.O=S=C1N=c2ccccc2=N1.
What is the InChIKey of N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole?
The InChIKey is PFXQSXDUTRTCKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N.C7H4N2OS/c1-10(2)9-13(4)12-8-6-5-7-11(12)3;10-11-7-8-5-3-1-2-4-6(5)9-7/h5-8,10H,9H2,1-4H3;1-4H.
What are the key properties of N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole?
N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole has a molecular weight of 341.48 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-N-(2-methylpropyl)aniline;2-sulfinylbenzimidazole is sourced from PubChem (CID 87173322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).