C15H25NO2S — CID 174404620
N,2-dimethyl-N-(2-methylpropyl)aniline;sulfanyl propanoate (PubChem CID 174404620) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is N,2-dimethyl-N-(2-methylpropyl)aniline;sulfanyl propanoate.
| Compound Name | N,2-dimethyl-N-(2-methylpropyl)aniline;sulfanyl propanoate |
|---|---|
| PubChem CID | 174404620 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N,2-dimethyl-N-(2-methylpropyl)aniline;sulfanyl propanoate |
| SMILES | CCC(=O)OS.Cc1ccccc1N(C)CC(C)C |
| InChI | InChI=1S/C12H19N.C3H6O2S/c1-10(2)9-13(4)12-8-6-5-7-11(12)3;1-2-3(4)5-6/h5-8,10H,9H2,1-4H3;6H,2H2,1H3 |
| InChIKey | HHSSLIRAWCDTSS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|