C16H26N2O4S — CID 141484131
3,4-dihexyl-2,5-dinitrothiophene (PubChem CID 141484131) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is 3,4-dihexyl-2,5-dinitrothiophene.
| Compound Name | 3,4-dihexyl-2,5-dinitrothiophene |
|---|---|
| PubChem CID | 141484131 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3,4-dihexyl-2,5-dinitrothiophene |
| SMILES | CCCCCCc1c([N+](=O)[O-])sc([N+](=O)[O-])c1CCCCCC |
| InChI | InChI=1S/C16H26N2O4S/c1-3-5-7-9-11-13-14(12-10-8-6-4-2)16(18(21)22)23-15(13)17(19)20/h3-12H2,1-2H3 |
| InChIKey | ZTJHRGKFNTVFMC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|