C19H36N2O3 — CID 141484953
2-dodec-1-enyl-N-(3-hydroxypropyl)butanediamide (PubChem CID 141484953) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-dodec-1-enyl-N-(3-hydroxypropyl)butanediamide.
| Compound Name | 2-dodec-1-enyl-N-(3-hydroxypropyl)butanediamide |
|---|---|
| PubChem CID | 141484953 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | 2-dodec-1-enyl-N-(3-hydroxypropyl)butanediamide |
| SMILES | CCCCCCCCCCC=CC(CC(N)=O)C(=O)NCCCO |
| InChI | InChI=1S/C19H36N2O3/c1-2-3-4-5-6-7-8-9-10-11-13-17(16-18(20)23)19(24)21-14-12-15-22/h11,13,17,22H,2-10,12,14-16H2,1H3,(H2,20,23)(H,21,24) |
| InChIKey | SUGFEWIWIJJCBV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|