C28H54N2O2 — CID 87965247
2-[(E)-dodec-1-enyl]-N,N'-dihexylbutanediamide (PubChem CID 87965247) has the molecular formula C28H54N2O2 and a molecular weight of 450.75 g/mol. Its IUPAC name is 2-[(E)-dodec-1-enyl]-N,N'-dihexylbutanediamide.
| Compound Name | 2-[(E)-dodec-1-enyl]-N,N'-dihexylbutanediamide |
|---|---|
| PubChem CID | 87965247 |
| Molecular Formula | C28H54N2O2 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.42 |
| IUPAC Name | 2-[(E)-dodec-1-enyl]-N,N'-dihexylbutanediamide |
| SMILES | CCCCCCCCCC/C=C/C(CC(=O)NCCCCCC)C(=O)NCCCCCC |
| InChI | InChI=1S/C28H54N2O2/c1-4-7-10-13-14-15-16-17-18-19-22-26(28(32)30-24-21-12-9-6-3)25-27(31)29-23-20-11-8-5-2/h19,22,26H,4-18,20-21,23-25H2,1-3H3,(H,29,31)(H,30,32)/b22-19+ |
| InChIKey | LLKUXLDCIPNIFM-ZBJSNUHESA-N |
| XLogP | 7.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|