C14H26N2O4 — CID 141484994
2-hex-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide (PubChem CID 141484994) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-hex-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide.
| Compound Name | 2-hex-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide |
|---|---|
| PubChem CID | 141484994 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-hex-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide |
| SMILES | CCCCC=CC(CC(N)=O)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C14H26N2O4/c1-2-3-4-5-6-12(11-13(15)19)14(20)16(7-9-17)8-10-18/h5-6,12,17-18H,2-4,7-11H2,1H3,(H2,15,19) |
| InChIKey | CPKKMXHMNSISJA-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|